C18H18N2O4 — CID 22610641
9-(1,3-dioxolan-2-yl)-N,N-dimethyl-7-nitro-9H-fluoren-2-amine (PubChem CID 22610641) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 9-(1,3-dioxolan-2-yl)-N,N-dimethyl-7-nitro-9H-fluoren-2-amine.
| Compound Name | 9-(1,3-dioxolan-2-yl)-N,N-dimethyl-7-nitro-9H-fluoren-2-amine |
|---|---|
| PubChem CID | 22610641 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 9-(1,3-dioxolan-2-yl)-N,N-dimethyl-7-nitro-9H-fluoren-2-amine |
| SMILES | CN(C)c1ccc2c(c1)C(C1OCCO1)c1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C18H18N2O4/c1-19(2)11-3-5-13-14-6-4-12(20(21)22)10-16(14)17(15(13)9-11)18-23-7-8-24-18/h3-6,9-10,17-18H,7-8H2,1-2H3 |
| InChIKey | DKXZWJSSAGNURF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|