C44H56N2O12+2 — CID 22615879
1,2-bis[8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 22615879) has the molecular formula C44H56N2O12+2 and a molecular weight of 804.93 g/mol. Its IUPAC name is 1,2-bis[8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | 1,2-bis[8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 22615879 |
| Molecular Formula | C44H56N2O12+2 |
| Molecular Weight | 804.93 g/mol |
| Exact Mass | 804.38 |
| IUPAC Name | 1,2-bis[8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CC(=O)Oc1ccc(C[N+]2(C)C3CCC2CC(C2(C(=O)O)CCC2(C(=O)O)C2CC4CCC(C2)[N+]4(C)Cc2ccc(OC(C)=O)c(OC(C)=O)c2)C3)cc1OC(C)=O |
| InChI | InChI=1S/C44H54N2O12/c1-25(47)55-37-13-7-29(17-39(37)57-27(3)49)23-45(5)33-9-10-34(45)20-31(19-33)43(41(51)52)15-16-44(43,42(53)54)32-21-35-11-12-36(22-32)46(35,6)24-30-8-14-38(56-26(2)48)40(18-30)58-28(4)50/h7-8,13-14,17-18,31-36H,9-12,15-16,19-24H2,1-6H3/p+2 |
| InChIKey | IAYWABNRDFVJOU-UHFFFAOYSA-P |
| XLogP | 5.80 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.93 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|