C23H31Br2NO8 — CID 173269689
2-[(1S,5R)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-4-hydroxy-4-oxobutanoate;dihydrobromide (PubChem CID 173269689) has the molecular formula C23H31Br2NO8 and a molecular weight of 609.31 g/mol. Its IUPAC name is 2-[(1S,5R)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-4-hydroxy-4-oxobutanoate;dihydrobromide.
| Compound Name | 2-[(1S,5R)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-4-hydroxy-4-oxobutanoate;dihydrobromide |
|---|---|
| PubChem CID | 173269689 |
| Molecular Formula | C23H31Br2NO8 |
| Molecular Weight | 609.31 g/mol |
| Exact Mass | 607.04 |
| IUPAC Name | 2-[(1S,5R)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-4-hydroxy-4-oxobutanoate;dihydrobromide |
| SMILES | Br.Br.CC(=O)Oc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2CC(C(CC(=O)O)C(=O)[O-])C3)cc1OC(C)=O |
| InChI | InChI=1S/C23H29NO8.2BrH/c1-13(25)31-20-7-4-15(8-21(20)32-14(2)26)12-24(3)17-5-6-18(24)10-16(9-17)19(23(29)30)11-22(27)28;;/h4,7-8,16-19H,5-6,9-12H2,1-3H3,(H-,27,28,29,30);2*1H/t16?,17-,18+,19?,24?;; |
| InChIKey | OPONMBSFKKLRTI-IAKFQEALSA-N |
| XLogP | 2.42 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|