C46H60N2O12+2 — CID 157214408
bis[(1R,5S)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate (PubChem CID 157214408) has the molecular formula C46H60N2O12+2 and a molecular weight of 832.99 g/mol. Its IUPAC name is bis[(1R,5S)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate.
| Compound Name | bis[(1R,5S)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 157214408 |
| Molecular Formula | C46H60N2O12+2 |
| Molecular Weight | 832.99 g/mol |
| Exact Mass | 832.41 |
| IUPAC Name | bis[(1R,5S)-8-[(3,4-diacetyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate |
| SMILES | CC(=O)Oc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2CC(OC(=O)C2CCCC(C(=O)OC4C[C@H]5CC[C@@H](C4)[N+]5(C)Cc4ccc(OC(C)=O)c(OC(C)=O)c4)C2)C3)cc1OC(C)=O |
| InChI | InChI=1S/C46H60N2O12/c1-27(49)55-41-16-10-31(18-43(41)57-29(3)51)25-47(5)35-12-13-36(47)22-39(21-35)59-45(53)33-8-7-9-34(20-33)46(54)60-40-23-37-14-15-38(24-40)48(37,6)26-32-11-17-42(56-28(2)50)44(19-32)58-30(4)52/h10-11,16-19,33-40H,7-9,12-15,20-26H2,1-6H3/q+2/t33?,34?,35-,36+,37-,38+,39?,40?,47?,48? |
| InChIKey | QYMSKFLFMDFTRY-DISJIQLLSA-N |
| XLogP | 6.26 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.99 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|