C30H24F3N3O4S — CID 22620013
N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]phenyl]methyl]-2-[2-(trifluoromethoxy)phenyl]acetamide (PubChem CID 22620013) has the molecular formula C30H24F3N3O4S and a molecular weight of 579.60 g/mol. Its IUPAC name is N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]phenyl]methyl]-2-[2-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]phenyl]methyl]-2-[2-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 22620013 |
| Molecular Formula | C30H24F3N3O4S |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]phenyl]methyl]-2-[2-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N#CNS(=O)(=O)c1ccccc1-c1ccc(CN(Cc2ccccc2)C(=O)Cc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C30H24F3N3O4S/c31-30(32,33)40-27-12-6-4-10-25(27)18-29(37)36(19-22-8-2-1-3-9-22)20-23-14-16-24(17-15-23)26-11-5-7-13-28(26)41(38,39)35-21-34/h1-17,35H,18-20H2 |
| InChIKey | NEMJNGZIWAMBOU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|