C6H12NO8P — CID 22644547
[4-[formyl(hydroxy)amino]-2-hydroxy-2-(hydroxymethyl)-3-oxobutyl]phosphonic acid (PubChem CID 22644547) has the molecular formula C6H12NO8P and a molecular weight of 257.13 g/mol. Its IUPAC name is [4-[formyl(hydroxy)amino]-2-hydroxy-2-(hydroxymethyl)-3-oxobutyl]phosphonic acid.
| Compound Name | [4-[formyl(hydroxy)amino]-2-hydroxy-2-(hydroxymethyl)-3-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 22644547 |
| Molecular Formula | C6H12NO8P |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | [4-[formyl(hydroxy)amino]-2-hydroxy-2-(hydroxymethyl)-3-oxobutyl]phosphonic acid |
| SMILES | O=CN(O)CC(=O)C(O)(CO)CP(=O)(O)O |
| InChI | InChI=1S/C6H12NO8P/c8-2-6(11,3-16(13,14)15)5(10)1-7(12)4-9/h4,8,11-12H,1-3H2,(H2,13,14,15) |
| InChIKey | IMLIXBLSZVLVQW-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|