C22H27BrN2O2S — CID 22671530
2-(4-octyl-1,3-thiazol-3-ium-3-yl)-1-(3-phenyl-1,2-oxazol-5-yl)ethanone bromide (PubChem CID 22671530) has the molecular formula C22H27BrN2O2S and a molecular weight of 463.44 g/mol. Its IUPAC name is 2-(4-octyl-1,3-thiazol-3-ium-3-yl)-1-(3-phenyl-1,2-oxazol-5-yl)ethanone bromide.
| Compound Name | 2-(4-octyl-1,3-thiazol-3-ium-3-yl)-1-(3-phenyl-1,2-oxazol-5-yl)ethanone bromide |
|---|---|
| PubChem CID | 22671530 |
| Molecular Formula | C22H27BrN2O2S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-(4-octyl-1,3-thiazol-3-ium-3-yl)-1-(3-phenyl-1,2-oxazol-5-yl)ethanone bromide |
| SMILES | CCCCCCCCc1csc[n+]1CC(=O)c1cc(-c2ccccc2)no1.[Br-] |
| InChI | InChI=1S/C22H27N2O2S.BrH/c1-2-3-4-5-6-10-13-19-16-27-17-24(19)15-21(25)22-14-20(23-26-22)18-11-8-7-9-12-18;/h7-9,11-12,14,16-17H,2-6,10,13,15H2,1H3;1H/q+1;/p-1 |
| InChIKey | PCFZDIKQKKSBHH-UHFFFAOYSA-M |
| XLogP | 2.48 |
| TPSA | 46.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|