C19H19F3O — CID 22709063
6-propyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 22709063) has the molecular formula C19H19F3O and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-propyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol.
| Compound Name | 6-propyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 22709063 |
| Molecular Formula | C19H19F3O |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 6-propyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | CCCc1ccc2c(c1)CCC(O)(c1cc(F)c(F)c(F)c1)C2 |
| InChI | InChI=1S/C19H19F3O/c1-2-3-12-4-5-14-11-19(23,7-6-13(14)8-12)15-9-16(20)18(22)17(21)10-15/h4-5,8-10,23H,2-3,6-7,11H2,1H3 |
| InChIKey | SBFVNDZMFRQTGZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|