C21H19NO5S — CID 22724817
2-[[(Z)-3-(1-benzothiophen-3-yl)but-2-enoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 22724817) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-[[(Z)-3-(1-benzothiophen-3-yl)but-2-enoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[(Z)-3-(1-benzothiophen-3-yl)but-2-enoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 22724817 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[[(Z)-3-(1-benzothiophen-3-yl)but-2-enoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)/C=C(/C)c2csc3ccccc23)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C21H19NO5S/c1-12(15-11-28-19-7-5-4-6-13(15)19)8-20(23)22-16-10-18(27-3)17(26-2)9-14(16)21(24)25/h4-11H,1-3H3,(H,22,23)(H,24,25)/b12-8- |
| InChIKey | ZRTMWQRRAAAHPD-WQLSENKSSA-N |
| XLogP | 4.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|