C28H18Cl8O4 — CID 22725877
2,6-dichloro-4-[1,4,4-tris(3,5-dichloro-4-hydroxyphenyl)butyl]phenol (PubChem CID 22725877) has the molecular formula C28H18Cl8O4 and a molecular weight of 702.07 g/mol. Its IUPAC name is 2,6-dichloro-4-[1,4,4-tris(3,5-dichloro-4-hydroxyphenyl)butyl]phenol.
| Compound Name | 2,6-dichloro-4-[1,4,4-tris(3,5-dichloro-4-hydroxyphenyl)butyl]phenol |
|---|---|
| PubChem CID | 22725877 |
| Molecular Formula | C28H18Cl8O4 |
| Molecular Weight | 702.07 g/mol |
| Exact Mass | 697.87 |
| IUPAC Name | 2,6-dichloro-4-[1,4,4-tris(3,5-dichloro-4-hydroxyphenyl)butyl]phenol |
| SMILES | Oc1c(Cl)cc(C(CCC(c2cc(Cl)c(O)c(Cl)c2)c2cc(Cl)c(O)c(Cl)c2)c2cc(Cl)c(O)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C28H18Cl8O4/c29-17-3-11(4-18(30)25(17)37)15(12-5-19(31)26(38)20(32)6-12)1-2-16(13-7-21(33)27(39)22(34)8-13)14-9-23(35)28(40)24(36)10-14/h3-10,15-16,37-40H,1-2H2 |
| InChIKey | SGMFTGBGYKSFDK-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.07 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |