C23H22O4S — CID 22734542
2-(2-ethenylnaphthalen-1-yl)oxybut-3-enyl 4-methylbenzenesulfonate (PubChem CID 22734542) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-(2-ethenylnaphthalen-1-yl)oxybut-3-enyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-ethenylnaphthalen-1-yl)oxybut-3-enyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22734542 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-(2-ethenylnaphthalen-1-yl)oxybut-3-enyl 4-methylbenzenesulfonate |
| SMILES | C=Cc1ccc2ccccc2c1OC(C=C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H22O4S/c1-4-18-12-13-19-8-6-7-9-22(19)23(18)27-20(5-2)16-26-28(24,25)21-14-10-17(3)11-15-21/h4-15,20H,1-2,16H2,3H3 |
| InChIKey | NQYHWPRWILFGDH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|