C20H22O4S — CID 72830032
2-(2-prop-1-enylphenoxy)but-3-enyl 4-methylbenzenesulfonate (PubChem CID 72830032) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-(2-prop-1-enylphenoxy)but-3-enyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-prop-1-enylphenoxy)but-3-enyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 72830032 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-(2-prop-1-enylphenoxy)but-3-enyl 4-methylbenzenesulfonate |
| SMILES | C=CC(COS(=O)(=O)c1ccc(C)cc1)Oc1ccccc1C=CC |
| InChI | InChI=1S/C20H22O4S/c1-4-8-17-9-6-7-10-20(17)24-18(5-2)15-23-25(21,22)19-13-11-16(3)12-14-19/h4-14,18H,2,15H2,1,3H3 |
| InChIKey | ZHRRSJREQWQCPI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|