C26H23Cl2FO4S — CID 173140044
[(2S)-2-[2-(2,4-dichlorophenyl)-3-fluoro-6-prop-1-enylphenoxy]but-3-enyl] 4-methylbenzenesulfonate (PubChem CID 173140044) has the molecular formula C26H23Cl2FO4S and a molecular weight of 521.44 g/mol. Its IUPAC name is [(2S)-2-[2-(2,4-dichlorophenyl)-3-fluoro-6-prop-1-enylphenoxy]but-3-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[2-(2,4-dichlorophenyl)-3-fluoro-6-prop-1-enylphenoxy]but-3-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173140044 |
| Molecular Formula | C26H23Cl2FO4S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [(2S)-2-[2-(2,4-dichlorophenyl)-3-fluoro-6-prop-1-enylphenoxy]but-3-enyl] 4-methylbenzenesulfonate |
| SMILES | C=C[C@@H](COS(=O)(=O)c1ccc(C)cc1)Oc1c(C=CC)ccc(F)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H23Cl2FO4S/c1-4-6-18-9-14-24(29)25(22-13-10-19(27)15-23(22)28)26(18)33-20(5-2)16-32-34(30,31)21-11-7-17(3)8-12-21/h4-15,20H,2,16H2,1,3H3/t20-/m0/s1 |
| InChIKey | IANFPRCTVOHVLE-FQEVSTJZSA-N |
| XLogP | 7.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|