C7H5N3S — CID 22744082
3-pyridin-2-yl-1,2,4-thiadiazole (PubChem CID 22744082) has the molecular formula C7H5N3S and a molecular weight of 163.20 g/mol. Its IUPAC name is 3-pyridin-2-yl-1,2,4-thiadiazole.
| Compound Name | 3-pyridin-2-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 22744082 |
| Molecular Formula | C7H5N3S |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 3-pyridin-2-yl-1,2,4-thiadiazole |
| SMILES | c1ccc(-c2ncsn2)nc1 |
| InChI | InChI=1S/C7H5N3S/c1-2-4-8-6(3-1)7-9-5-11-10-7/h1-5H |
| InChIKey | RFRSALCCKAHJRR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |