C19H28O3 — CID 22760101
(E)-9-(1,3-benzodioxol-5-yl)-6-ethyl-2-methylnon-6-en-2-ol (PubChem CID 22760101) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (E)-9-(1,3-benzodioxol-5-yl)-6-ethyl-2-methylnon-6-en-2-ol.
| Compound Name | (E)-9-(1,3-benzodioxol-5-yl)-6-ethyl-2-methylnon-6-en-2-ol |
|---|---|
| PubChem CID | 22760101 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (E)-9-(1,3-benzodioxol-5-yl)-6-ethyl-2-methylnon-6-en-2-ol |
| SMILES | CC/C(=C\CCc1ccc2c(c1)OCO2)CCCC(C)(C)O |
| InChI | InChI=1S/C19H28O3/c1-4-15(9-6-12-19(2,3)20)7-5-8-16-10-11-17-18(13-16)22-14-21-17/h7,10-11,13,20H,4-6,8-9,12,14H2,1-3H3/b15-7+ |
| InChIKey | GZBVHWQQLJJUKP-VIZOYTHASA-N |
| XLogP | 4.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|