C24H38O3 — CID 70625083
(E)-11-(1,3-benzodioxol-5-yl)-5-butyl-8-ethylundec-8-en-5-ol (PubChem CID 70625083) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (E)-11-(1,3-benzodioxol-5-yl)-5-butyl-8-ethylundec-8-en-5-ol.
| Compound Name | (E)-11-(1,3-benzodioxol-5-yl)-5-butyl-8-ethylundec-8-en-5-ol |
|---|---|
| PubChem CID | 70625083 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (E)-11-(1,3-benzodioxol-5-yl)-5-butyl-8-ethylundec-8-en-5-ol |
| SMILES | CCCCC(O)(CCCC)CC/C(=C/CCc1ccc2c(c1)OCO2)CC |
| InChI | InChI=1S/C24H38O3/c1-4-7-15-24(25,16-8-5-2)17-14-20(6-3)10-9-11-21-12-13-22-23(18-21)27-19-26-22/h10,12-13,18,25H,4-9,11,14-17,19H2,1-3H3/b20-10+ |
| InChIKey | JWTMHZBLRIABBC-KEBDBYFISA-N |
| XLogP | 6.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|