C17H19BrClN3O3S2 — CID 22760454
2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)-N-phenylbenzenesulfonamide;hydrobromide (PubChem CID 22760454) has the molecular formula C17H19BrClN3O3S2 and a molecular weight of 492.85 g/mol. Its IUPAC name is 2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)-N-phenylbenzenesulfonamide;hydrobromide.
| Compound Name | 2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)-N-phenylbenzenesulfonamide;hydrobromide |
|---|---|
| PubChem CID | 22760454 |
| Molecular Formula | C17H19BrClN3O3S2 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | 2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)-N-phenylbenzenesulfonamide;hydrobromide |
| SMILES | Br.C/N=C1\SCC(O)(c2ccc(Cl)c(S(=O)(=O)Nc3ccccc3)c2)N1C |
| InChI | InChI=1S/C17H18ClN3O3S2.BrH/c1-19-16-21(2)17(22,11-25-16)12-8-9-14(18)15(10-12)26(23,24)20-13-6-4-3-5-7-13;/h3-10,20,22H,11H2,1-2H3;1H/b19-16-; |
| InChIKey | KKRWRYWVWCZZHP-JWJVXZKMSA-N |
| XLogP | 3.53 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|