C14H21ClN3O3S2+ — CID 21316692
[4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]-diethylazanium (PubChem CID 21316692) has the molecular formula C14H21ClN3O3S2+ and a molecular weight of 378.93 g/mol. Its IUPAC name is [4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]-diethylazanium.
| Compound Name | [4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 21316692 |
| Molecular Formula | C14H21ClN3O3S2+ |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=C1SCC(O)(c2ccc(Cl)c(S(N)(=O)=O)c2)N1C |
| InChI | InChI=1S/C14H21ClN3O3S2/c1-4-18(5-2)13-17(3)14(19,9-22-13)10-6-7-11(15)12(8-10)23(16,20)21/h6-8,19H,4-5,9H2,1-3H3,(H2,16,20,21)/q+1 |
| InChIKey | XKGKYZJBLGWHGG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|