C11H13ClN2O3S3 — CID 22756385
2-chloro-5-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidin-4-yl)benzenesulfonamide (PubChem CID 22756385) has the molecular formula C11H13ClN2O3S3 and a molecular weight of 352.89 g/mol. Its IUPAC name is 2-chloro-5-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidin-4-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22756385 |
| Molecular Formula | C11H13ClN2O3S3 |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 2-chloro-5-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazolidin-4-yl)benzenesulfonamide |
| SMILES | CCN1C(=S)SCC1(O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H13ClN2O3S3/c1-2-14-10(18)19-6-11(14,15)7-3-4-8(12)9(5-7)20(13,16)17/h3-5,15H,2,6H2,1H3,(H2,13,16,17) |
| InChIKey | WQWUTWMSBWWPAA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|