C21H35Cl2N3O3S2 — CID 22760537
2-chloro-5-(3-hexyl-2-hexylimino-4-hydroxy-1,3-thiazolidin-4-yl)benzenesulfonamide;hydrochloride (PubChem CID 22760537) has the molecular formula C21H35Cl2N3O3S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-chloro-5-(3-hexyl-2-hexylimino-4-hydroxy-1,3-thiazolidin-4-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-chloro-5-(3-hexyl-2-hexylimino-4-hydroxy-1,3-thiazolidin-4-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22760537 |
| Molecular Formula | C21H35Cl2N3O3S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2-chloro-5-(3-hexyl-2-hexylimino-4-hydroxy-1,3-thiazolidin-4-yl)benzenesulfonamide;hydrochloride |
| SMILES | CCCCCC/N=C1\SCC(O)(c2ccc(Cl)c(S(N)(=O)=O)c2)N1CCCCCC.Cl |
| InChI | InChI=1S/C21H34ClN3O3S2.ClH/c1-3-5-7-9-13-24-20-25(14-10-8-6-4-2)21(26,16-29-20)17-11-12-18(22)19(15-17)30(23,27)28;/h11-12,15,26H,3-10,13-14,16H2,1-2H3,(H2,23,27,28);1H/b24-20-; |
| InChIKey | VEYGQMKAAZZNCI-RKEQJQHUSA-N |
| XLogP | 5.12 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|