C10H11ClN2O4S2 — CID 22756390
2-chloro-5-(4-hydroxy-3-methyl-2-oxo-1,3-thiazolidin-4-yl)benzenesulfonamide (PubChem CID 22756390) has the molecular formula C10H11ClN2O4S2 and a molecular weight of 322.80 g/mol. Its IUPAC name is 2-chloro-5-(4-hydroxy-3-methyl-2-oxo-1,3-thiazolidin-4-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(4-hydroxy-3-methyl-2-oxo-1,3-thiazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22756390 |
| Molecular Formula | C10H11ClN2O4S2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-chloro-5-(4-hydroxy-3-methyl-2-oxo-1,3-thiazolidin-4-yl)benzenesulfonamide |
| SMILES | CN1C(=O)SCC1(O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H11ClN2O4S2/c1-13-9(14)18-5-10(13,15)6-2-3-7(11)8(4-6)19(12,16)17/h2-4,15H,5H2,1H3,(H2,12,16,17) |
| InChIKey | UGLGALSGXFFJQR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|