C18H29Cl2N3O3S2 — CID 21316715
dibutyl-[4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]azanium chloride (PubChem CID 21316715) has the molecular formula C18H29Cl2N3O3S2 and a molecular weight of 470.49 g/mol. Its IUPAC name is dibutyl-[4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]azanium chloride.
| Compound Name | dibutyl-[4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]azanium chloride |
|---|---|
| PubChem CID | 21316715 |
| Molecular Formula | C18H29Cl2N3O3S2 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | dibutyl-[4-(4-chloro-3-sulfamoylphenyl)-4-hydroxy-3-methyl-1,3-thiazolidin-2-ylidene]azanium chloride |
| SMILES | CCCC[N+](CCCC)=C1SCC(O)(c2ccc(Cl)c(S(N)(=O)=O)c2)N1C.[Cl-] |
| InChI | InChI=1S/C18H29ClN3O3S2.ClH/c1-4-6-10-22(11-7-5-2)17-21(3)18(23,13-26-17)14-8-9-15(19)16(12-14)27(20,24)25;/h8-9,12,23H,4-7,10-11,13H2,1-3H3,(H2,20,24,25);1H/q+1;/p-1 |
| InChIKey | XPTQHJPUMPJQOE-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|