C15H16ClN3O7S2-2 — CID 131710962
(Z)-but-2-enedioate;2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)benzenesulfonamide (PubChem CID 131710962) has the molecular formula C15H16ClN3O7S2-2 and a molecular weight of 449.89 g/mol. Its IUPAC name is (Z)-but-2-enedioate;2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)benzenesulfonamide.
| Compound Name | (Z)-but-2-enedioate;2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 131710962 |
| Molecular Formula | C15H16ClN3O7S2-2 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | (Z)-but-2-enedioate;2-chloro-5-(4-hydroxy-3-methyl-2-methylimino-1,3-thiazolidin-4-yl)benzenesulfonamide |
| SMILES | C/N=C1\SCC(O)(c2ccc(Cl)c(S(N)(=O)=O)c2)N1C.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C11H14ClN3O3S2.C4H4O4/c1-14-10-15(2)11(16,6-19-10)7-3-4-8(12)9(5-7)20(13,17)18;5-3(6)1-2-4(7)8/h3-5,16H,6H2,1-2H3,(H2,13,17,18);1-2H,(H,5,6)(H,7,8)/p-2/b14-10-;2-1- |
| InChIKey | JTEWILUJRNHIBL-DSHZJHIISA-L |
| XLogP | -2.16 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|