C15H18ClN3O3S2 — CID 22760470
2-chloro-5-(2-cyclopropylimino-4-hydroxy-3-prop-2-enyl-1,3-thiazolidin-4-yl)benzenesulfonamide (PubChem CID 22760470) has the molecular formula C15H18ClN3O3S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-chloro-5-(2-cyclopropylimino-4-hydroxy-3-prop-2-enyl-1,3-thiazolidin-4-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(2-cyclopropylimino-4-hydroxy-3-prop-2-enyl-1,3-thiazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22760470 |
| Molecular Formula | C15H18ClN3O3S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-chloro-5-(2-cyclopropylimino-4-hydroxy-3-prop-2-enyl-1,3-thiazolidin-4-yl)benzenesulfonamide |
| SMILES | C=CCN1/C(=N/C2CC2)SCC1(O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H18ClN3O3S2/c1-2-7-19-14(18-11-4-5-11)23-9-15(19,20)10-3-6-12(16)13(8-10)24(17,21)22/h2-3,6,8,11,20H,1,4-5,7,9H2,(H2,17,21,22)/b18-14- |
| InChIKey | QJDFJYSCXYJPTG-JXAWBTAJSA-N |
| XLogP | 1.89 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|