C16H31NO — CID 22796786
(E,2R,6R)-N,N,2,6,10-pentamethylundec-3-enamide (PubChem CID 22796786) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is (E,2R,6R)-N,N,2,6,10-pentamethylundec-3-enamide.
| Compound Name | (E,2R,6R)-N,N,2,6,10-pentamethylundec-3-enamide |
|---|---|
| PubChem CID | 22796786 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (E,2R,6R)-N,N,2,6,10-pentamethylundec-3-enamide |
| SMILES | CC(C)CCC[C@@H](C)C/C=C/[C@@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C16H31NO/c1-13(2)9-7-10-14(3)11-8-12-15(4)16(18)17(5)6/h8,12-15H,7,9-11H2,1-6H3/b12-8+/t14-,15-/m1/s1 |
| InChIKey | GMXKHROGRWUHIC-OFCDUSSDSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|