C22H33NO2 — CID 22799140
(1S,3aS,7aS)-4-[2-(3-aminophenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 22799140) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1S,3aS,7aS)-4-[2-(3-aminophenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (1S,3aS,7aS)-4-[2-(3-aminophenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 22799140 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (1S,3aS,7aS)-4-[2-(3-aminophenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC(C)(C)O[C@H]1CC[C@H]2C(CCc3cccc(N)c3)C(=O)CC[C@]12C |
| InChI | InChI=1S/C22H33NO2/c1-21(2,3)25-20-11-10-18-17(19(24)12-13-22(18,20)4)9-8-15-6-5-7-16(23)14-15/h5-7,14,17-18,20H,8-13,23H2,1-4H3/t17?,18-,20-,22-/m0/s1 |
| InChIKey | FSTMJZMKVISANN-GEMLBAIUSA-N |
| XLogP | 4.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|