C18H25N3O2 — CID 89144028
tert-butyl N-[2-[2-(3-aminophenyl)ethyl]-2,3-dihydropyridin-4-yl]carbamate (PubChem CID 89144028) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(3-aminophenyl)ethyl]-2,3-dihydropyridin-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(3-aminophenyl)ethyl]-2,3-dihydropyridin-4-yl]carbamate |
|---|---|
| PubChem CID | 89144028 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl N-[2-[2-(3-aminophenyl)ethyl]-2,3-dihydropyridin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=CC=NC(CCc2cccc(N)c2)C1 |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)23-17(22)21-16-9-10-20-15(12-16)8-7-13-5-4-6-14(19)11-13/h4-6,9-11,15H,7-8,12,19H2,1-3H3,(H,21,22) |
| InChIKey | LXCSUIHRTPPHMU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|