C31H48O6 — CID 22803240
[(3S,8R,9S,10S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 22803240) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [(3S,8R,9S,10S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 22803240 |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | [(3S,8R,9S,10S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CC[C@H](OC3CCCCO3)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC3CCCCO3)CC[C@@H]12 |
| InChI | InChI=1S/C31H48O6/c1-21(32)35-20-31-16-13-23(36-28-7-3-5-17-33-28)19-22(31)9-10-24-25-11-12-27(30(25,2)15-14-26(24)31)37-29-8-4-6-18-34-29/h19,23-29H,3-18,20H2,1-2H3/t23-,24-,25-,26-,27-,28?,29?,30-,31+/m0/s1 |
| InChIKey | HNYPBKTYQPUOBQ-LWYWALSLSA-N |
| XLogP | 6.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|