C19H23NO5S — CID 22803463
1-acetyloxyethyl (2S,5R)-2-benzyl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22803463) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-acetyloxyethyl (2S,5R)-2-benzyl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1-acetyloxyethyl (2S,5R)-2-benzyl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22803463 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-acetyloxyethyl (2S,5R)-2-benzyl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)OC(C)OC(=O)[C@]1(Cc2ccccc2)N2C(=O)C[C@H]2SC1(C)C |
| InChI | InChI=1S/C19H23NO5S/c1-12(21)24-13(2)25-17(23)19(11-14-8-6-5-7-9-14)18(3,4)26-16-10-15(22)20(16)19/h5-9,13,16H,10-11H2,1-4H3/t13?,16-,19+/m1/s1 |
| InChIKey | LFOCRRBDEOMUCW-HIYLDEIPSA-N |
| XLogP | 2.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|