C18H19Cl3N2O5S — CID 88753384
7-oxabicyclo[4.1.0]hepta-1,3,5-triene;2,2,2-trichloroethyl (5R)-2-acetamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88753384) has the molecular formula C18H19Cl3N2O5S and a molecular weight of 481.79 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;2,2,2-trichloroethyl (5R)-2-acetamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;2,2,2-trichloroethyl (5R)-2-acetamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88753384 |
| Molecular Formula | C18H19Cl3N2O5S |
| Molecular Weight | 481.79 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;2,2,2-trichloroethyl (5R)-2-acetamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)NC1(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)C[C@H]2SC1(C)C.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C12H15Cl3N2O4S.C6H4O/c1-6(18)16-12(9(20)21-5-11(13,14)15)10(2,3)22-8-4-7(19)17(8)12;1-2-4-6-5(3-1)7-6/h8H,4-5H2,1-3H3,(H,16,18);1-4H/t8-,12?;/m1./s1 |
| InChIKey | KELOJKDGNHOGEG-CFKUEIMKSA-N |
| XLogP | 3.61 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|