C25H25N5O9S — CID 70551811
(2S,5R)-2-[[2-[formamido-[(4-nitro-2-phenylphenyl)methoxycarbonyl]amino]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 70551811) has the molecular formula C25H25N5O9S and a molecular weight of 571.57 g/mol. Its IUPAC name is (2S,5R)-2-[[2-[formamido-[(4-nitro-2-phenylphenyl)methoxycarbonyl]amino]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-2-[[2-[formamido-[(4-nitro-2-phenylphenyl)methoxycarbonyl]amino]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70551811 |
| Molecular Formula | C25H25N5O9S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | (2S,5R)-2-[[2-[formamido-[(4-nitro-2-phenylphenyl)methoxycarbonyl]amino]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2CC(=O)N2[C@@]1(NC(=O)CN(NC=O)C(=O)OCc1ccc([N+](=O)[O-])cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H25N5O9S/c1-24(2)25(22(34)35,29-20(33)11-21(29)40-24)27-19(32)12-28(26-14-31)23(36)39-13-16-8-9-17(30(37)38)10-18(16)15-6-4-3-5-7-15/h3-10,14,21H,11-13H2,1-2H3,(H,26,31)(H,27,32)(H,34,35)/t21-,25+/m1/s1 |
| InChIKey | MOMHWAFYXPCWGA-BWKNWUBXSA-N |
| XLogP | 1.84 |
| TPSA | 188.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|