C10H14N2O — CID 22841823
2-[(1,1-dideuterio-2-phenylethyl)amino]acetamide (PubChem CID 22841823) has the molecular formula C10H14N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(1,1-dideuterio-2-phenylethyl)amino]acetamide.
| Compound Name | 2-[(1,1-dideuterio-2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 22841823 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[(1,1-dideuterio-2-phenylethyl)amino]acetamide |
| SMILES | [2H]C([2H])(Cc1ccccc1)NCC(N)=O |
| InChI | InChI=1S/C10H14N2O/c11-10(13)8-12-7-6-9-4-2-1-3-5-9/h1-5,12H,6-8H2,(H2,11,13)/i7D2 |
| InChIKey | SRFNZJUMTYLFEO-RJSZUWSASA-N |
| XLogP | 0.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |