C17H30O8 — CID 22845335
(3-methyl-2-propan-2-ylcyclohexyl) (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylate (PubChem CID 22845335) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is (3-methyl-2-propan-2-ylcyclohexyl) (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylate.
| Compound Name | (3-methyl-2-propan-2-ylcyclohexyl) (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 22845335 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (3-methyl-2-propan-2-ylcyclohexyl) (2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
| SMILES | CC(C)C1C(C)CCCC1OC(=O)[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H30O8/c1-8(2)12-9(3)5-4-6-10(12)24-16(22)17(23)15(21)14(20)13(19)11(7-18)25-17/h8-15,18-21,23H,4-7H2,1-3H3/t9?,10?,11-,12?,13-,14+,15-,17+/m1/s1 |
| InChIKey | ZHJJWIYOZXLZJU-DCOZZFOQSA-N |
| XLogP | -0.85 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |