C30H58O4Si2 — CID 22850325
[(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methanol (PubChem CID 22850325) has the molecular formula C30H58O4Si2 and a molecular weight of 538.96 g/mol. Its IUPAC name is [(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methanol.
| Compound Name | [(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methanol |
|---|---|
| PubChem CID | 22850325 |
| Molecular Formula | C30H58O4Si2 |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | [(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methanol |
| SMILES | CCCCCC(C)(/C=C/[C@H]1[C@H]2CC3(CO)OC3[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O4Si2/c1-13-14-15-17-29(8,34-36(11,12)28(5,6)7)18-16-22-24-20-30(21-31)26(32-30)23(24)19-25(22)33-35(9,10)27(2,3)4/h16,18,22-26,31H,13-15,17,19-21H2,1-12H3/b18-16+/t22-,23-,24+,25+,26?,29?,30?/m0/s1 |
| InChIKey | QNBLJNRIJZCTQL-JMWGVAKYSA-N |
| XLogP | 8.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|