C31H58O6SSi2 — CID 57027204
[(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate (PubChem CID 57027204) has the molecular formula C31H58O6SSi2 and a molecular weight of 615.04 g/mol. Its IUPAC name is [(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate.
| Compound Name | [(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 57027204 |
| Molecular Formula | C31H58O6SSi2 |
| Molecular Weight | 615.04 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | [(1S,6S,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C=C[C@H]1[C@H]2CC3(COS(C)(=O)=O)OC3[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H58O6SSi2/c1-29(2,3)39(8,9)36-26(22-15-13-12-14-16-22)18-17-23-25-20-31(21-34-38(7,32)33)28(35-31)24(25)19-27(23)37-40(10,11)30(4,5)6/h17-18,22-28H,12-16,19-21H2,1-11H3/t23-,24-,25+,26+,27+,28?,31?/m0/s1 |
| InChIKey | BOWSMCZQUGWLKB-KJTYQYIFSA-N |
| XLogP | 7.67 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.04 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|