C22H29NO9SSi-2 — CID 22850868
(5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate (PubChem CID 22850868) has the molecular formula C22H29NO9SSi-2 and a molecular weight of 511.63 g/mol. Its IUPAC name is (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate.
| Compound Name | (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate |
|---|---|
| PubChem CID | 22850868 |
| Molecular Formula | C22H29NO9SSi-2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate |
| SMILES | COc1cc(O[Si](C)(C)C(C)(C)C)c2c(c1)C(=O)O[C@H](C(=O)[O-])CC(=O)N[C@H](C(=O)[O-])CSC2 |
| InChI | InChI=1S/C22H31NO9SSi/c1-22(2,3)34(5,6)32-16-8-12(30-4)7-13-14(16)10-33-11-15(19(25)26)23-18(24)9-17(20(27)28)31-21(13)29/h7-8,15,17H,9-11H2,1-6H3,(H,23,24)(H,25,26)(H,27,28)/p-2/t15-,17-/m0/s1 |
| InChIKey | KWFNQNYWZSAVCN-RDJZCZTQSA-L |
| XLogP | 0.23 |
| TPSA | 154.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|