C24H35NO9SSi — CID 56610338
dimethyl (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate (PubChem CID 56610338) has the molecular formula C24H35NO9SSi and a molecular weight of 541.70 g/mol. Its IUPAC name is dimethyl (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate.
| Compound Name | dimethyl (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate |
|---|---|
| PubChem CID | 56610338 |
| Molecular Formula | C24H35NO9SSi |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | dimethyl (5R,9S)-16-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CSCc2c(O[Si](C)(C)C(C)(C)C)cc(OC)cc2C(=O)O[C@H](C(=O)OC)CC(=O)N1 |
| InChI | InChI=1S/C24H35NO9SSi/c1-24(2,3)36(7,8)34-18-10-14(30-4)9-15-16(18)12-35-13-17(22(28)31-5)25-20(26)11-19(23(29)32-6)33-21(15)27/h9-10,17,19H,11-13H2,1-8H3,(H,25,26)/t17-,19-/m0/s1 |
| InChIKey | QRQXENOHICLFAF-HKUYNNGSSA-N |
| XLogP | 3.07 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|