C18H21NO9S — CID 54247589
dimethyl (5R,9S)-16-hydroxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate (PubChem CID 54247589) has the molecular formula C18H21NO9S and a molecular weight of 427.43 g/mol. Its IUPAC name is dimethyl (5R,9S)-16-hydroxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate.
| Compound Name | dimethyl (5R,9S)-16-hydroxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate |
|---|---|
| PubChem CID | 54247589 |
| Molecular Formula | C18H21NO9S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | dimethyl (5R,9S)-16-hydroxy-14-methoxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5,9-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CSCc2c(O)cc(OC)cc2C(=O)O[C@H](C(=O)OC)CC(=O)N1 |
| InChI | InChI=1S/C18H21NO9S/c1-25-9-4-10-11(13(20)5-9)7-29-8-12(17(23)26-2)19-15(21)6-14(18(24)27-3)28-16(10)22/h4-5,12,14,20H,6-8H2,1-3H3,(H,19,21)/t12-,14-/m0/s1 |
| InChIKey | QUJPLTLAQBZXIW-JSGCOSHPSA-N |
| XLogP | 0.39 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|