C20H34O5Si — CID 22852555
methyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate (PubChem CID 22852555) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is methyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate.
| Compound Name | methyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 22852555 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | methyl (1S,3aR,6aR)-5-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-2-oxo-3,3a,6,6a-tetrahydro-1H-pentalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C[C@H]2C=C(CCOCCO[Si](C)(C)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C20H34O5Si/c1-20(2,3)26(5,6)25-10-9-24-8-7-14-11-15-13-17(21)18(16(15)12-14)19(22)23-4/h11,15-16,18H,7-10,12-13H2,1-6H3/t15-,16-,18+/m1/s1 |
| InChIKey | KINBYPGZEWIJHU-NUJGCVRESA-N |
| XLogP | 3.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|