C22H30O4 — CID 22852714
(2'R,3'aS,6'aR)-2'-(5-phenylmethoxypentyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-one (PubChem CID 22852714) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2'R,3'aS,6'aR)-2'-(5-phenylmethoxypentyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-one.
| Compound Name | (2'R,3'aS,6'aR)-2'-(5-phenylmethoxypentyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-one |
|---|---|
| PubChem CID | 22852714 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2'R,3'aS,6'aR)-2'-(5-phenylmethoxypentyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-one |
| SMILES | O=C1[C@H](CCCCCOCc2ccccc2)C[C@H]2CC3(C[C@@H]12)OCCO3 |
| InChI | InChI=1S/C22H30O4/c23-21-18(13-19-14-22(15-20(19)21)25-11-12-26-22)9-5-2-6-10-24-16-17-7-3-1-4-8-17/h1,3-4,7-8,18-20H,2,5-6,9-16H2/t18-,19+,20-/m1/s1 |
| InChIKey | ORHOFJSDYOVKLP-HSALFYBXSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|