C35H43ClO5 — CID 22859169
1-[4-[(2S)-2-chloro-4-methylpentoxy]carbonylphenyl]-6-undec-10-enoxynaphthalene-2-carboxylic acid (PubChem CID 22859169) has the molecular formula C35H43ClO5 and a molecular weight of 579.18 g/mol. Its IUPAC name is 1-[4-[(2S)-2-chloro-4-methylpentoxy]carbonylphenyl]-6-undec-10-enoxynaphthalene-2-carboxylic acid.
| Compound Name | 1-[4-[(2S)-2-chloro-4-methylpentoxy]carbonylphenyl]-6-undec-10-enoxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 22859169 |
| Molecular Formula | C35H43ClO5 |
| Molecular Weight | 579.18 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 1-[4-[(2S)-2-chloro-4-methylpentoxy]carbonylphenyl]-6-undec-10-enoxynaphthalene-2-carboxylic acid |
| SMILES | C=CCCCCCCCCCOc1ccc2c(-c3ccc(C(=O)OC[C@@H](Cl)CC(C)C)cc3)c(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C35H43ClO5/c1-4-5-6-7-8-9-10-11-12-21-40-30-18-20-31-28(23-30)17-19-32(34(37)38)33(31)26-13-15-27(16-14-26)35(39)41-24-29(36)22-25(2)3/h4,13-20,23,25,29H,1,5-12,21-22,24H2,2-3H3,(H,37,38)/t29-/m0/s1 |
| InChIKey | ZYCHAFXYLRSZPJ-LJAQVGFWSA-N |
| XLogP | 9.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.18 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|