C30H41N9O7 — CID 22862332
phenyl (5R)-5-amino-2-(aminomethyl)-6-[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-oxohexanoate (PubChem CID 22862332) has the molecular formula C30H41N9O7 and a molecular weight of 639.71 g/mol. Its IUPAC name is phenyl (5R)-5-amino-2-(aminomethyl)-6-[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-oxohexanoate.
| Compound Name | phenyl (5R)-5-amino-2-(aminomethyl)-6-[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 22862332 |
| Molecular Formula | C30H41N9O7 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | phenyl (5R)-5-amino-2-(aminomethyl)-6-[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-oxohexanoate |
| SMILES | NCC(CC[C@@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C30H41N9O7/c31-18-19(29(43)46-22-6-2-1-3-7-22)10-15-23(32)28(42)38-17-5-9-25(38)27(41)37-24(8-4-16-35-30(33)34)26(40)36-20-11-13-21(14-12-20)39(44)45/h1-3,6-7,11-14,19,23-25H,4-5,8-10,15-18,31-32H2,(H,36,40)(H,37,41)(H4,33,34,35)/t19?,23-,24+,25+/m1/s1 |
| InChIKey | WUUQRRQGGAFDEV-YXEUUWGCSA-N |
| XLogP | 0.35 |
| TPSA | 264.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|