C22H34N5O5+ — CID 22863521
2-[(3S,5S)-3-(2-amino-2-oxoethyl)-5-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]-1-(2-methylpropyl)-2-oxopyrrolidin-1-ium-1-yl]acetic acid (PubChem CID 22863521) has the molecular formula C22H34N5O5+ and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[(3S,5S)-3-(2-amino-2-oxoethyl)-5-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]-1-(2-methylpropyl)-2-oxopyrrolidin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[(3S,5S)-3-(2-amino-2-oxoethyl)-5-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]-1-(2-methylpropyl)-2-oxopyrrolidin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 22863521 |
| Molecular Formula | C22H34N5O5+ |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 2-[(3S,5S)-3-(2-amino-2-oxoethyl)-5-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]-1-(2-methylpropyl)-2-oxopyrrolidin-1-ium-1-yl]acetic acid |
| SMILES | CC(C)C[N+]1(CC(=O)O)C(=O)[C@H](CC(N)=O)C[C@H]1COc1ccc(CCN=C(N)N)cc1 |
| InChI | InChI=1S/C22H33N5O5/c1-14(2)11-27(12-20(29)30)17(9-16(21(27)31)10-19(23)28)13-32-18-5-3-15(4-6-18)7-8-26-22(24)25/h3-6,14,16-17H,7-13H2,1-2H3,(H6-,23,24,25,26,28,29,30)/p+1/t16-,17-,27?/m0/s1 |
| InChIKey | UZXOIGYJZICYPO-LIBSGGPOSA-O |
| XLogP | 0.23 |
| TPSA | 171.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|