C12H20NO3P — CID 22873479
[(2S)-2-amino-1-hydroxy-4-methylpentyl]-phenylphosphinic acid (PubChem CID 22873479) has the molecular formula C12H20NO3P and a molecular weight of 257.27 g/mol. Its IUPAC name is [(2S)-2-amino-1-hydroxy-4-methylpentyl]-phenylphosphinic acid.
| Compound Name | [(2S)-2-amino-1-hydroxy-4-methylpentyl]-phenylphosphinic acid |
|---|---|
| PubChem CID | 22873479 |
| Molecular Formula | C12H20NO3P |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | [(2S)-2-amino-1-hydroxy-4-methylpentyl]-phenylphosphinic acid |
| SMILES | CC(C)C[C@H](N)C(O)P(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C12H20NO3P/c1-9(2)8-11(13)12(14)17(15,16)10-6-4-3-5-7-10/h3-7,9,11-12,14H,8,13H2,1-2H3,(H,15,16)/t11-,12?/m0/s1 |
| InChIKey | SQBXQNZVSZBLID-PXYINDEMSA-N |
| XLogP | 1.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|