C18H22N4O5S2 — CID 22874024
(4-nitrophenyl)methyl (2S,4S)-2-[2-(cyanomethylamino)-1-ethylsulfanyl-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 22874024) has the molecular formula C18H22N4O5S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[2-(cyanomethylamino)-1-ethylsulfanyl-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[2-(cyanomethylamino)-1-ethylsulfanyl-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22874024 |
| Molecular Formula | C18H22N4O5S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[2-(cyanomethylamino)-1-ethylsulfanyl-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CCSC(C(=O)NCC#N)[C@@H]1C[C@H](S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H22N4O5S2/c1-2-29-16(17(23)20-8-7-19)15-9-14(28)10-21(15)18(24)27-11-12-3-5-13(6-4-12)22(25)26/h3-6,14-16,28H,2,8-11H2,1H3,(H,20,23)/t14-,15-,16?/m0/s1 |
| InChIKey | GYVMKMNLBIOTDW-KSCSMHSMSA-N |
| XLogP | 2.37 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|