C19H19BFNO2 — CID 22888263
CID 22888263 (PubChem CID 22888263) has the molecular formula C19H19BFNO2 and a molecular weight of 323.18 g/mol.
| Compound Name | CID 22888263 |
|---|---|
| PubChem CID | 22888263 |
| Molecular Formula | C19H19BFNO2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC(O)(c2cccc(Cc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C19H19BFNO2/c20-18(23)22-10-8-19(24,9-11-22)16-3-1-2-15(13-16)12-14-4-6-17(21)7-5-14/h1-7,13,24H,8-12H2 |
| InChIKey | IKDSBAYUNVNLLL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|