C12H14NOP — CID 22894615
1,3-dimethyl-3,4-dihydro-[1,3,2]oxazaphosphinino[3,4-a]indole (PubChem CID 22894615) has the molecular formula C12H14NOP and a molecular weight of 219.22 g/mol. Its IUPAC name is 1,3-dimethyl-3,4-dihydro-[1,3,2]oxazaphosphinino[3,4-a]indole.
| Compound Name | 1,3-dimethyl-3,4-dihydro-[1,3,2]oxazaphosphinino[3,4-a]indole |
|---|---|
| PubChem CID | 22894615 |
| Molecular Formula | C12H14NOP |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1,3-dimethyl-3,4-dihydro-[1,3,2]oxazaphosphinino[3,4-a]indole |
| SMILES | CC1Cc2cc3ccccc3n2P(C)O1 |
| InChI | InChI=1S/C12H14NOP/c1-9-7-11-8-10-5-3-4-6-12(10)13(11)15(2)14-9/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | TXIGAUBSDCTYNQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|