C25H31N4+ — CID 22895903
1,3,5,6-tetramethyl-2-[(E)-3-(1,3,5,6-tetramethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]benzimidazole (PubChem CID 22895903) has the molecular formula C25H31N4+ and a molecular weight of 387.55 g/mol. Its IUPAC name is 1,3,5,6-tetramethyl-2-[(E)-3-(1,3,5,6-tetramethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]benzimidazole.
| Compound Name | 1,3,5,6-tetramethyl-2-[(E)-3-(1,3,5,6-tetramethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]benzimidazole |
|---|---|
| PubChem CID | 22895903 |
| Molecular Formula | C25H31N4+ |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1,3,5,6-tetramethyl-2-[(E)-3-(1,3,5,6-tetramethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]benzimidazole |
| SMILES | Cc1cc2c(cc1C)N(C)C(=C/C=C/c1n(C)c3cc(C)c(C)cc3[n+]1C)N2C |
| InChI | InChI=1S/C25H31N4/c1-16-12-20-21(13-17(16)2)27(6)24(26(20)5)10-9-11-25-28(7)22-14-18(3)19(4)15-23(22)29(25)8/h9-15H,1-8H3/q+1 |
| InChIKey | VMMBEGFMVYUVSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|