C31H27IN4 — CID 126476200
(2Z)-1-methyl-2-[(E)-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-phenylbenzimidazole iodide (PubChem CID 126476200) has the molecular formula C31H27IN4 and a molecular weight of 582.49 g/mol. Its IUPAC name is (2Z)-1-methyl-2-[(E)-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-phenylbenzimidazole iodide.
| Compound Name | (2Z)-1-methyl-2-[(E)-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-phenylbenzimidazole iodide |
|---|---|
| PubChem CID | 126476200 |
| Molecular Formula | C31H27IN4 |
| Molecular Weight | 582.49 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | (2Z)-1-methyl-2-[(E)-3-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)prop-2-enylidene]-3-phenylbenzimidazole iodide |
| SMILES | CN1/C(=C/C=C/c2n(-c3ccccc3)c3ccccc3[n+]2C)N(c2ccccc2)c2ccccc21.[I-] |
| InChI | InChI=1S/C31H27N4.HI/c1-32-26-18-9-11-20-28(26)34(24-14-5-3-6-15-24)30(32)22-13-23-31-33(2)27-19-10-12-21-29(27)35(31)25-16-7-4-8-17-25;/h3-23H,1-2H3;1H/q+1;/p-1 |
| InChIKey | STQBPQYCUCIHCI-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|