C34H62N2O8 — CID 22900076
4-O-[2-[4-(4-methoxybutanoyloxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] 1-O-[2-[4-(methoxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] butanedioate (PubChem CID 22900076) has the molecular formula C34H62N2O8 and a molecular weight of 626.88 g/mol. Its IUPAC name is 4-O-[2-[4-(4-methoxybutanoyloxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] 1-O-[2-[4-(methoxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] butanedioate.
| Compound Name | 4-O-[2-[4-(4-methoxybutanoyloxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] 1-O-[2-[4-(methoxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] butanedioate |
|---|---|
| PubChem CID | 22900076 |
| Molecular Formula | C34H62N2O8 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.45 |
| IUPAC Name | 4-O-[2-[4-(4-methoxybutanoyloxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] 1-O-[2-[4-(methoxymethyl)-2,2,6,6-tetramethylpiperidin-1-yl]ethyl] butanedioate |
| SMILES | COCCCC(=O)OCC1CC(C)(C)N(CCOC(=O)CCC(=O)OCCN2C(C)(C)CC(COC)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C34H62N2O8/c1-31(2)20-26(24-41-10)21-32(3,4)35(31)15-18-42-29(38)13-14-30(39)43-19-16-36-33(5,6)22-27(23-34(36,7)8)25-44-28(37)12-11-17-40-9/h26-27H,11-25H2,1-10H3 |
| InChIKey | XSZPSQOUQKIYPW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|